C20H27NO3 — CID 748446
5-tert-butyl-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-methylfuran-3-carboxamide (PubChem CID 748446) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 5-tert-butyl-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-methylfuran-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 748446 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-tert-butyl-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1cc(O)c(C(C)C)cc1NC(=O)c1cc(C(C)(C)C)oc1C |
| InChI | InChI=1S/C20H27NO3/c1-11(2)14-9-16(12(3)8-17(14)22)21-19(23)15-10-18(20(5,6)7)24-13(15)4/h8-11,22H,1-7H3,(H,21,23) |
| InChIKey | HWUALEDHKVHWLS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|