About 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone
1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone (PubChem CID 7484530) has the molecular formula C18H17FN2O2S
and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone.
Molecular Properties
| Compound Name | 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone |
| PubChem CID | 7484530 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone |
| SMILES | Cc1cc(-n2c(C)cc(C(=O)CSc3ccccc3F)c2C)no1 |
| InChI | InChI=1S/C18H17FN2O2S/c1-11-8-14(13(3)21(11)18-9-12(2)23-20-18)16(22)10-24-17-7-5-4-6-15(17)19/h4-9H,10H2,1-3H3 |
| InChIKey | PORWEZSMCYYMAR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone?
The IUPAC name of 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone (CID 7484530) is 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone.
What is the SMILES notation for 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone?
The canonical SMILES for 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone is Cc1cc(-n2c(C)cc(C(=O)CSc3ccccc3F)c2C)no1.
What is the InChIKey of 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone?
The InChIKey is PORWEZSMCYYMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O2S/c1-11-8-14(13(3)21(11)18-9-12(2)23-20-18)16(22)10-24-17-7-5-4-6-15(17)19/h4-9H,10H2,1-3H3.
What are the key properties of 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone?
1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone has a molecular weight of 344.41 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-2-(2-fluorophenyl)sulfanylethanone is sourced from PubChem (CID 7484530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).