About [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate
[(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (PubChem CID 7485283) has the molecular formula C11H11BrF2N2O5S
and a molecular weight of 401.19 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| PubChem CID | 7485283 |
| Molecular Formula | C11H11BrF2N2O5S |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| SMILES | C[C@@H](OC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br)C(N)=O |
| InChI | InChI=1S/C11H11BrF2N2O5S/c1-5(11(15)18)21-9(17)4-16-22(19,20)10-7(12)2-6(13)3-8(10)14/h2-3,5,16H,4H2,1H3,(H2,15,18)/t5-/m1/s1 |
| InChIKey | FZFPFAALNFQOLM-RXMQYKEDSA-N |
| XLogP | 0.42 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The IUPAC name of [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (CID 7485283) is [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
What is the SMILES notation for [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The canonical SMILES for [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is C[C@@H](OC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br)C(N)=O.
What is the InChIKey of [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The InChIKey is FZFPFAALNFQOLM-RXMQYKEDSA-N. The full InChI is InChI=1S/C11H11BrF2N2O5S/c1-5(11(15)18)21-9(17)4-16-22(19,20)10-7(12)2-6(13)3-8(10)14/h2-3,5,16H,4H2,1H3,(H2,15,18)/t5-/m1/s1.
What are the key properties of [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
[(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate has a molecular weight of 401.19 g/mol, XLogP of 0.42, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-amino-1-oxopropan-2-yl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 7485283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).