About [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate
[(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (PubChem CID 7485286) has the molecular formula C11H9BrF2N2O4S
and a molecular weight of 383.17 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| PubChem CID | 7485286 |
| Molecular Formula | C11H9BrF2N2O4S |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| SMILES | C[C@H](C#N)OC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H9BrF2N2O4S/c1-6(4-15)20-10(17)5-16-21(18,19)11-8(12)2-7(13)3-9(11)14/h2-3,6,16H,5H2,1H3/t6-/m1/s1 |
| InChIKey | UQTCXLFYDSYHII-ZCFIWIBFSA-N |
| XLogP | 1.46 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The IUPAC name of [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (CID 7485286) is [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The canonical SMILES for [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is C[C@H](C#N)OC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br.
What is the InChIKey of [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The InChIKey is UQTCXLFYDSYHII-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H9BrF2N2O4S/c1-6(4-15)20-10(17)5-16-21(18,19)11-8(12)2-7(13)3-9(11)14/h2-3,6,16H,5H2,1H3/t6-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
[(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate has a molecular weight of 383.17 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 7485286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).