About cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate
cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (PubChem CID 7485287) has the molecular formula C10H7BrF2N2O4S
and a molecular weight of 369.14 g/mol. Its IUPAC name is cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| PubChem CID | 7485287 |
| Molecular Formula | C10H7BrF2N2O4S |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate |
| SMILES | N#CCOC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H7BrF2N2O4S/c11-7-3-6(12)4-8(13)10(7)20(17,18)15-5-9(16)19-2-1-14/h3-4,15H,2,5H2 |
| InChIKey | ODQRFOWIYFRTLT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The IUPAC name of cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate (CID 7485287) is cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate.
What is the SMILES notation for cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The canonical SMILES for cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is N#CCOC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1Br.
What is the InChIKey of cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
The InChIKey is ODQRFOWIYFRTLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF2N2O4S/c11-7-3-6(12)4-8(13)10(7)20(17,18)15-5-9(16)19-2-1-14/h3-4,15H,2,5H2.
What are the key properties of cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate?
cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate has a molecular weight of 369.14 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 2-[(2-bromo-4,6-difluorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 7485287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).