C18H15FN2O6 — CID 7485685
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7485685) has the molecular formula C18H15FN2O6 and a molecular weight of 374.32 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7485685 |
| Molecular Formula | C18H15FN2O6 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C18H15FN2O6/c1-26-16-10-13(21(24)25)7-8-15(16)20-17(22)11-27-18(23)9-6-12-4-2-3-5-14(12)19/h2-10H,11H2,1H3,(H,20,22)/b9-6+ |
| InChIKey | CCVUAUHIPPCKMO-RMKNXTFCSA-N |
| XLogP | 2.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|