C21H18N4 — CID 748631
N-(2,5-dimethylphenyl)-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 748631) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-(2,5-dimethylphenyl)-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 748631 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | Cc1ccc(C)c(Nc2nc(-c3ccncc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H18N4/c1-14-7-8-15(2)19(13-14)24-21-17-5-3-4-6-18(17)23-20(25-21)16-9-11-22-12-10-16/h3-13H,1-2H3,(H,23,24,25) |
| InChIKey | HZLCLAGHLCKFLZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |