C18H20N2OS — CID 748660
(5,6-dimethyl-3-prop-2-enyl-2,4-dihydrothieno[2,3-d]pyrimidin-1-yl)-phenylmethanone (PubChem CID 748660) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (5,6-dimethyl-3-prop-2-enyl-2,4-dihydrothieno[2,3-d]pyrimidin-1-yl)-phenylmethanone.
| Compound Name | (5,6-dimethyl-3-prop-2-enyl-2,4-dihydrothieno[2,3-d]pyrimidin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 748660 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (5,6-dimethyl-3-prop-2-enyl-2,4-dihydrothieno[2,3-d]pyrimidin-1-yl)-phenylmethanone |
| SMILES | C=CCN1Cc2c(sc(C)c2C)N(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N2OS/c1-4-10-19-11-16-13(2)14(3)22-18(16)20(12-19)17(21)15-8-6-5-7-9-15/h4-9H,1,10-12H2,2-3H3 |
| InChIKey | VFYWNMHQSDHWIT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|