C21H22O3 — CID 748688
9-(4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 748688) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 9-(4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 748688 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 9-(4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CCc1ccc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C21H22O3/c1-2-13-9-11-14(12-10-13)19-20-15(22)5-3-7-17(20)24-18-8-4-6-16(23)21(18)19/h9-12,19H,2-8H2,1H3 |
| InChIKey | BRDVMQRQHUHNAY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |