C15H14FN3O4S — CID 7488009
4-fluoro-N-[[5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide (PubChem CID 7488009) has the molecular formula C15H14FN3O4S and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-fluoro-N-[[5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 7488009 |
| Molecular Formula | C15H14FN3O4S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-fluoro-N-[[5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3,4-oxadiazol-2-yl]methyl]benzamide |
| SMILES | CC(=O)/C(Sc1nnc(CNC(=O)c2ccc(F)cc2)o1)=C(\C)O |
| InChI | InChI=1S/C15H14FN3O4S/c1-8(20)13(9(2)21)24-15-19-18-12(23-15)7-17-14(22)10-3-5-11(16)6-4-10/h3-6,20H,7H2,1-2H3,(H,17,22)/b13-8- |
| InChIKey | VFNNMPNZLJTOTJ-JYRVWZFOSA-N |
| XLogP | 2.61 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|