About 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran
3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran (PubChem CID 748824) has the molecular formula C17H16O2
and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran |
| PubChem CID | 748824 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran |
| SMILES | COc1ccc(-c2c(C)oc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C17H16O2/c1-11-4-9-16-15(10-11)17(12(2)19-16)13-5-7-14(18-3)8-6-13/h4-10H,1-3H3 |
| InChIKey | FXVQFWIQTJDXLZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran?
The IUPAC name of 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran (CID 748824) is 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran.
What is the SMILES notation for 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran?
The canonical SMILES for 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran is COc1ccc(-c2c(C)oc3ccc(C)cc23)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran?
The InChIKey is FXVQFWIQTJDXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O2/c1-11-4-9-16-15(10-11)17(12(2)19-16)13-5-7-14(18-3)8-6-13/h4-10H,1-3H3.
What are the key properties of 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran?
3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran has a molecular weight of 252.31 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-2,5-dimethyl-1-benzofuran is sourced from PubChem (CID 748824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).