About 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine
1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (PubChem CID 74889028) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
Analyze 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The IUPAC name of 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine (CID 74889028) is 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine.
What is the SMILES notation for 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The canonical SMILES for 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is Cc1nc(C)n2c1CNCC2.
What is the InChIKey of 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
The InChIKey is PJGDNWHBPXCOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-8-5-9-3-4-11(8)7(2)10-6/h9H,3-5H2,1-2H3.
What are the key properties of 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine?
1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine has a molecular weight of 151.21 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine is sourced from PubChem (CID 74889028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).