About 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine
6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 74889140) has the molecular formula C6H5BrN4
and a molecular weight of 213.04 g/mol. Its IUPAC name is 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine.
Analyze 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The IUPAC name of 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine (CID 74889140) is 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine.
What is the SMILES notation for 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The canonical SMILES for 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine is Cc1nnc2ncc(Br)cn12.
What is the InChIKey of 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The InChIKey is IDUOFFYKXUXWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4/c1-4-9-10-6-8-2-5(7)3-11(4)6/h2-3H,1H3.
What are the key properties of 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine?
6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine has a molecular weight of 213.04 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyrimidine is sourced from PubChem (CID 74889140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).