C10H14N2 — CID 74889204
(5-ethenyl-6-ethyl-3-pyridinyl)methanamine (PubChem CID 74889204) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (5-ethenyl-6-ethyl-3-pyridinyl)methanamine.
| Compound Name | (5-ethenyl-6-ethyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 74889204 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (5-ethenyl-6-ethyl-3-pyridinyl)methanamine |
| SMILES | C=Cc1cc(CN)cnc1CC |
| InChI | InChI=1S/C10H14N2/c1-3-9-5-8(6-11)7-12-10(9)4-2/h3,5,7H,1,4,6,11H2,2H3 |
| InChIKey | CNEHBYKYDPZATM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |