About 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine
2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 74889398) has the molecular formula C11H13ClN4
and a molecular weight of 236.71 g/mol. Its IUPAC name is 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 74889398 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CCN(CC)c1nc(Cl)nc2cccnc12 |
| InChI | InChI=1S/C11H13ClN4/c1-3-16(4-2)10-9-8(6-5-7-13-9)14-11(12)15-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | BVRSXOHTYPPHOK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine (CID 74889398) is 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine is CCN(CC)c1nc(Cl)nc2cccnc12.
What is the InChIKey of 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is BVRSXOHTYPPHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4/c1-3-16(4-2)10-9-8(6-5-7-13-9)14-11(12)15-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine?
2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 236.71 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethylpyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 74889398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).