About 2-methylazetidin-3-ol;hydrochloride
2-methylazetidin-3-ol;hydrochloride (PubChem CID 74889767) has the molecular formula C4H10ClNO
and a molecular weight of 123.58 g/mol. Its IUPAC name is 2-methylazetidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-methylazetidin-3-ol;hydrochloride |
| PubChem CID | 74889767 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 2-methylazetidin-3-ol;hydrochloride |
| SMILES | CC1NCC1O.Cl |
| InChI | InChI=1S/C4H9NO.ClH/c1-3-4(6)2-5-3;/h3-6H,2H2,1H3;1H |
| InChIKey | VGWXJFDIRONLQP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylazetidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylazetidin-3-ol;hydrochloride?
The IUPAC name of 2-methylazetidin-3-ol;hydrochloride (CID 74889767) is 2-methylazetidin-3-ol;hydrochloride.
What is the SMILES notation for 2-methylazetidin-3-ol;hydrochloride?
The canonical SMILES for 2-methylazetidin-3-ol;hydrochloride is CC1NCC1O.Cl.
What is the InChIKey of 2-methylazetidin-3-ol;hydrochloride?
The InChIKey is VGWXJFDIRONLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.ClH/c1-3-4(6)2-5-3;/h3-6H,2H2,1H3;1H.
What are the key properties of 2-methylazetidin-3-ol;hydrochloride?
2-methylazetidin-3-ol;hydrochloride has a molecular weight of 123.58 g/mol, XLogP of -0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylazetidin-3-ol;hydrochloride is sourced from PubChem (CID 74889767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).