About (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride
(1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (PubChem CID 74889795) has the molecular formula C6H14Cl2N2
and a molecular weight of 185.10 g/mol. Its IUPAC name is (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride.
Molecular Properties
| Compound Name | (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| PubChem CID | 74889795 |
| Molecular Formula | C6H14Cl2N2 |
| Molecular Weight | 185.10 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| SMILES | CN1C[C@H]2C[C@@H]1CN2.Cl.Cl |
| InChI | InChI=1S/C6H12N2.2ClH/c1-8-4-5-2-6(8)3-7-5;;/h5-7H,2-4H2,1H3;2*1H/t5-,6-;;/m1../s1 |
| InChIKey | CPKLWCPJBAELNP-BNTLRKBRSA-N |
| XLogP | 0.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.10 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The IUPAC name of (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CID 74889795) is (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride.
What is the SMILES notation for (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The canonical SMILES for (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride is CN1C[C@H]2C[C@@H]1CN2.Cl.Cl.
What is the InChIKey of (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
The InChIKey is CPKLWCPJBAELNP-BNTLRKBRSA-N. The full InChI is InChI=1S/C6H12N2.2ClH/c1-8-4-5-2-6(8)3-7-5;;/h5-7H,2-4H2,1H3;2*1H/t5-,6-;;/m1../s1.
What are the key properties of (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride?
(1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride has a molecular weight of 185.10 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-2-methyl-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride is sourced from PubChem (CID 74889795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).