About 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride
2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride (PubChem CID 74889844) has the molecular formula C8H13BrCl2N2O
and a molecular weight of 304.02 g/mol. Its IUPAC name is 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride |
| PubChem CID | 74889844 |
| Molecular Formula | C8H13BrCl2N2O |
| Molecular Weight | 304.02 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc(Br)cc(CN)c1O |
| InChI | InChI=1S/C8H11BrN2O.2ClH/c9-7-1-5(3-10)8(12)6(2-7)4-11;;/h1-2,12H,3-4,10-11H2;2*1H |
| InChIKey | KBHRWAAABBDXFR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride?
The IUPAC name of 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride (CID 74889844) is 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride.
What is the SMILES notation for 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride?
The canonical SMILES for 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride is Cl.Cl.NCc1cc(Br)cc(CN)c1O.
What is the InChIKey of 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride?
The InChIKey is KBHRWAAABBDXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O.2ClH/c9-7-1-5(3-10)8(12)6(2-7)4-11;;/h1-2,12H,3-4,10-11H2;2*1H.
What are the key properties of 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride?
2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride has a molecular weight of 304.02 g/mol, XLogP of 1.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(aminomethyl)-4-bromophenol;dihydrochloride is sourced from PubChem (CID 74889844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).