About 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride
8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (PubChem CID 74889864) has the molecular formula C8H8BrCl2NO
and a molecular weight of 284.97 g/mol. Its IUPAC name is 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
Molecular Properties
| Compound Name | 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| PubChem CID | 74889864 |
| Molecular Formula | C8H8BrCl2NO |
| Molecular Weight | 284.97 g/mol |
| Exact Mass | 282.92 |
| IUPAC Name | 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| SMILES | Cl.Clc1cc(Br)c2c(c1)NCCO2 |
| InChI | InChI=1S/C8H7BrClNO.ClH/c9-6-3-5(10)4-7-8(6)12-2-1-11-7;/h3-4,11H,1-2H2;1H |
| InChIKey | XVTZJIQRUMCLKF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.97 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The IUPAC name of 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CID 74889864) is 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
What is the SMILES notation for 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The canonical SMILES for 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is Cl.Clc1cc(Br)c2c(c1)NCCO2.
What is the InChIKey of 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The InChIKey is XVTZJIQRUMCLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClNO.ClH/c9-6-3-5(10)4-7-8(6)12-2-1-11-7;/h3-4,11H,1-2H2;1H.
What are the key properties of 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride has a molecular weight of 284.97 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is sourced from PubChem (CID 74889864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).