About methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride
methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride (PubChem CID 74889914) has the molecular formula C20H25ClN2O2
and a molecular weight of 360.89 g/mol. Its IUPAC name is methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride |
| PubChem CID | 74889914 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1CN1CCN[C@@H](Cc2ccccc2)C1.Cl |
| InChI | InChI=1S/C20H24N2O2.ClH/c1-24-20(23)19-10-6-5-9-17(19)14-22-12-11-21-18(15-22)13-16-7-3-2-4-8-16;/h2-10,18,21H,11-15H2,1H3;1H/t18-;/m0./s1 |
| InChIKey | XVZCZOCOQPYMLC-FERBBOLQSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride?
The IUPAC name of methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride (CID 74889914) is methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride.
What is the SMILES notation for methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride?
The canonical SMILES for methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride is COC(=O)c1ccccc1CN1CCN[C@@H](Cc2ccccc2)C1.Cl.
What is the InChIKey of methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride?
The InChIKey is XVZCZOCOQPYMLC-FERBBOLQSA-N. The full InChI is InChI=1S/C20H24N2O2.ClH/c1-24-20(23)19-10-6-5-9-17(19)14-22-12-11-21-18(15-22)13-16-7-3-2-4-8-16;/h2-10,18,21H,11-15H2,1H3;1H/t18-;/m0./s1.
What are the key properties of methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride?
methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride has a molecular weight of 360.89 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(3S)-3-benzylpiperazin-1-yl]methyl]benzoate;hydrochloride is sourced from PubChem (CID 74889914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).