About [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate
[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7488994) has the molecular formula C19H17FN2O5
and a molecular weight of 372.35 g/mol. Its IUPAC name is [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| PubChem CID | 7488994 |
| Molecular Formula | C19H17FN2O5 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CCN(C(=O)COC(=O)Cn1c(=O)oc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O5/c1-2-21(14-9-7-13(20)8-10-14)17(23)12-26-18(24)11-22-15-5-3-4-6-16(15)27-19(22)25/h3-10H,2,11-12H2,1H3 |
| InChIKey | RAAMTCRZEVBDFE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The IUPAC name of [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (CID 7488994) is [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
What is the SMILES notation for [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The canonical SMILES for [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate is CCN(C(=O)COC(=O)Cn1c(=O)oc2ccccc21)c1ccc(F)cc1.
What is the InChIKey of [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The InChIKey is RAAMTCRZEVBDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O5/c1-2-21(14-9-7-13(20)8-10-14)17(23)12-26-18(24)11-22-15-5-3-4-6-16(15)27-19(22)25/h3-10H,2,11-12H2,1H3.
What are the key properties of [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate has a molecular weight of 372.35 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-ethyl-4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate is sourced from PubChem (CID 7488994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).