About (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride
(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride (PubChem CID 74889940) has the molecular formula C11H16ClNO2
and a molecular weight of 229.71 g/mol. Its IUPAC name is (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride |
| PubChem CID | 74889940 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride |
| SMILES | COc1ccc2c(c1)OCC(CN)C2.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-13-10-3-2-9-4-8(6-12)7-14-11(9)5-10;/h2-3,5,8H,4,6-7,12H2,1H3;1H |
| InChIKey | NDNBPQWGYUOFMI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride?
The IUPAC name of (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride (CID 74889940) is (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride?
The canonical SMILES for (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride is COc1ccc2c(c1)OCC(CN)C2.Cl.
What is the InChIKey of (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride?
The InChIKey is NDNBPQWGYUOFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.ClH/c1-13-10-3-2-9-4-8(6-12)7-14-11(9)5-10;/h2-3,5,8H,4,6-7,12H2,1H3;1H.
What are the key properties of (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride?
(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride has a molecular weight of 229.71 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-3,4-dihydro-2H-chromen-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 74889940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).