C15H20BN3O2 — CID 74890228
3-methyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]imidazo[4,5-b]pyridine (PubChem CID 74890228) has the molecular formula C15H20BN3O2 and a molecular weight of 285.16 g/mol. Its IUPAC name is 3-methyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]imidazo[4,5-b]pyridine.
| Compound Name | 3-methyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 74890228 |
| Molecular Formula | C15H20BN3O2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-methyl-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]imidazo[4,5-b]pyridine |
| SMILES | Cn1cnc2cc(/C=C/B3OC(C)(C)C(C)(C)O3)cnc21 |
| InChI | InChI=1S/C15H20BN3O2/c1-14(2)15(3,4)21-16(20-14)7-6-11-8-12-13(17-9-11)19(5)10-18-12/h6-10H,1-5H3/b7-6+ |
| InChIKey | UBKMZEZBPRASRY-VOTSOKGWSA-N |
| XLogP | 2.61 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|