About 2-bromo-1,4,5-trimethylimidazole
2-bromo-1,4,5-trimethylimidazole (PubChem CID 74890576) has the molecular formula C6H9BrN2
and a molecular weight of 189.06 g/mol. Its IUPAC name is 2-bromo-1,4,5-trimethylimidazole.
Molecular Properties
| Compound Name | 2-bromo-1,4,5-trimethylimidazole |
| PubChem CID | 74890576 |
| Molecular Formula | C6H9BrN2 |
| Molecular Weight | 189.06 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 2-bromo-1,4,5-trimethylimidazole |
| SMILES | Cc1nc(Br)n(C)c1C |
| InChI | InChI=1S/C6H9BrN2/c1-4-5(2)9(3)6(7)8-4/h1-3H3 |
| InChIKey | HGODMPYCRWDPJP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.06 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-1,4,5-trimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,4,5-trimethylimidazole?
The IUPAC name of 2-bromo-1,4,5-trimethylimidazole (CID 74890576) is 2-bromo-1,4,5-trimethylimidazole.
What is the SMILES notation for 2-bromo-1,4,5-trimethylimidazole?
The canonical SMILES for 2-bromo-1,4,5-trimethylimidazole is Cc1nc(Br)n(C)c1C.
What is the InChIKey of 2-bromo-1,4,5-trimethylimidazole?
The InChIKey is HGODMPYCRWDPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2/c1-4-5(2)9(3)6(7)8-4/h1-3H3.
What are the key properties of 2-bromo-1,4,5-trimethylimidazole?
2-bromo-1,4,5-trimethylimidazole has a molecular weight of 189.06 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,4,5-trimethylimidazole is sourced from PubChem (CID 74890576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).