About 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine
5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 74891232) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 74891232 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc2cc[nH]c2nc1OC |
| InChI | InChI=1S/C9H10N2O2/c1-12-7-5-6-3-4-10-8(6)11-9(7)13-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | BHISQMPGJQHROG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine (CID 74891232) is 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine is COc1cc2cc[nH]c2nc1OC.
What is the InChIKey of 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is BHISQMPGJQHROG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-12-7-5-6-3-4-10-8(6)11-9(7)13-2/h3-5H,1-2H3,(H,10,11).
What are the key properties of 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine?
5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 178.19 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 74891232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).