C9H10N2O2 — CID 74891232
5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 74891232) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 74891232 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 5,6-dimethoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cc2cc[nH]c2nc1OC |
| InChI | InChI=1S/C9H10N2O2/c1-12-7-5-6-3-4-10-8(6)11-9(7)13-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | BHISQMPGJQHROG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |