About (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol
(6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol (PubChem CID 74891260) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol.
Molecular Properties
| Compound Name | (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol |
| PubChem CID | 74891260 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol |
| SMILES | COc1cc(CO)c2cc[nH]c2n1 |
| InChI | InChI=1S/C9H10N2O2/c1-13-8-4-6(5-12)7-2-3-10-9(7)11-8/h2-4,12H,5H2,1H3,(H,10,11) |
| InChIKey | JWAZMSDTSGCSMS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol?
The IUPAC name of (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol (CID 74891260) is (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol.
What is the SMILES notation for (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol?
The canonical SMILES for (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol is COc1cc(CO)c2cc[nH]c2n1.
What is the InChIKey of (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol?
The InChIKey is JWAZMSDTSGCSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-13-8-4-6(5-12)7-2-3-10-9(7)11-8/h2-4,12H,5H2,1H3,(H,10,11).
What are the key properties of (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol?
(6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol has a molecular weight of 178.19 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-1H-pyrrolo[2,3-b]pyridin-4-yl)methanol is sourced from PubChem (CID 74891260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).