About N-methylethanethioamide;hydroiodide
N-methylethanethioamide;hydroiodide (PubChem CID 74891920) has the molecular formula C3H8INS
and a molecular weight of 217.07 g/mol. Its IUPAC name is N-methylethanethioamide;hydroiodide.
Molecular Properties
| Compound Name | N-methylethanethioamide;hydroiodide |
| PubChem CID | 74891920 |
| Molecular Formula | C3H8INS |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 216.94 |
| IUPAC Name | N-methylethanethioamide;hydroiodide |
| SMILES | CNC(C)=S.I |
| InChI | InChI=1S/C3H7NS.HI/c1-3(5)4-2;/h1-2H3,(H,4,5);1H |
| InChIKey | GAZHUGJQMZRNGJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-methylethanethioamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanethioamide;hydroiodide?
The IUPAC name of N-methylethanethioamide;hydroiodide (CID 74891920) is N-methylethanethioamide;hydroiodide.
What is the SMILES notation for N-methylethanethioamide;hydroiodide?
The canonical SMILES for N-methylethanethioamide;hydroiodide is CNC(C)=S.I.
What is the InChIKey of N-methylethanethioamide;hydroiodide?
The InChIKey is GAZHUGJQMZRNGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NS.HI/c1-3(5)4-2;/h1-2H3,(H,4,5);1H.
What are the key properties of N-methylethanethioamide;hydroiodide?
N-methylethanethioamide;hydroiodide has a molecular weight of 217.07 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanethioamide;hydroiodide is sourced from PubChem (CID 74891920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).