C12H12O3 — CID 74892498
spiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-carbaldehyde (PubChem CID 74892498) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-carbaldehyde.
| Compound Name | spiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-carbaldehyde |
|---|---|
| PubChem CID | 74892498 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | spiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C1(CC2)OCCO1 |
| InChI | InChI=1S/C12H12O3/c13-8-9-1-2-10-3-4-12(11(10)7-9)14-5-6-15-12/h1-2,7-8H,3-6H2 |
| InChIKey | OFSSZQKGBNZZAD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|