C19H16O3S — CID 7490353
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-benzothiophene-2-carboxylate (PubChem CID 7490353) has the molecular formula C19H16O3S and a molecular weight of 324.40 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-benzothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7490353 |
| Molecular Formula | C19H16O3S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H16O3S/c1-12-7-9-14(10-8-12)18(20)13(2)22-19(21)17-11-15-5-3-4-6-16(15)23-17/h3-11,13H,1-2H3/t13-/m1/s1 |
| InChIKey | VTNHVKGOFZUOHB-CYBMUJFWSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |