About [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate
[2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 7491265) has the molecular formula C22H24N2O4
and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| PubChem CID | 7491265 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | Cc1cccc(C)c1NC(=O)COC(=O)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-15-5-3-6-16(2)21(15)23-19(25)14-28-22(27)18-10-8-17(9-11-18)13-24-12-4-7-20(24)26/h3,5-6,8-11H,4,7,12-14H2,1-2H3,(H,23,25) |
| InChIKey | QQFNJJRNFKWLKS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate?
The IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (CID 7491265) is [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
What is the SMILES notation for [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate?
The canonical SMILES for [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate is Cc1cccc(C)c1NC(=O)COC(=O)c1ccc(CN2CCCC2=O)cc1.
What is the InChIKey of [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate?
The InChIKey is QQFNJJRNFKWLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4/c1-15-5-3-6-16(2)21(15)23-19(25)14-28-22(27)18-10-8-17(9-11-18)13-24-12-4-7-20(24)26/h3,5-6,8-11H,4,7,12-14H2,1-2H3,(H,23,25).
What are the key properties of [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate?
[2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate has a molecular weight of 380.44 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate is sourced from PubChem (CID 7491265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).