C19H23ClN6O2 — CID 74925015
1-(3-chlorophenyl)-3-[5-methyl-2-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)pyrazol-3-yl]urea (PubChem CID 74925015) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[5-methyl-2-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)pyrazol-3-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[5-methyl-2-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 74925015 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[5-methyl-2-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)pyrazol-3-yl]urea |
| SMILES | Cc1cc(NC(=O)Nc2cccc(Cl)c2)n(C2NC(=O)C3CCCCC3N2)n1 |
| InChI | InChI=1S/C19H23ClN6O2/c1-11-9-16(23-19(28)21-13-6-4-5-12(20)10-13)26(25-11)18-22-15-8-3-2-7-14(15)17(27)24-18/h4-6,9-10,14-15,18,22H,2-3,7-8H2,1H3,(H,24,27)(H2,21,23,28) |
| InChIKey | KDBBOOIGRJDRRU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |