C26H34N6O3 — CID 74925046
1-(4-butoxyphenyl)-3-[3-tert-butyl-1-(4-oxo-5,6,7,8-tetrahydro-4aH-quinazolin-2-yl)pyrazol-5-yl]urea (PubChem CID 74925046) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[3-tert-butyl-1-(4-oxo-5,6,7,8-tetrahydro-4aH-quinazolin-2-yl)pyrazol-5-yl]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[3-tert-butyl-1-(4-oxo-5,6,7,8-tetrahydro-4aH-quinazolin-2-yl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74925046 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[3-tert-butyl-1-(4-oxo-5,6,7,8-tetrahydro-4aH-quinazolin-2-yl)pyrazol-5-yl]urea |
| SMILES | CCCCOc1ccc(NC(=O)Nc2cc(C(C)(C)C)nn2C2=NC(=O)C3CCCCC3=N2)cc1 |
| InChI | InChI=1S/C26H34N6O3/c1-5-6-15-35-18-13-11-17(12-14-18)27-25(34)29-22-16-21(26(2,3)4)31-32(22)24-28-20-10-8-7-9-19(20)23(33)30-24/h11-14,16,19H,5-10,15H2,1-4H3,(H2,27,29,34) |
| InChIKey | MJPKBXJDQRSILU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|