C19H17BrN4O3 — CID 74925780
1-benzyl-5-(2-bromophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925780) has the molecular formula C19H17BrN4O3 and a molecular weight of 429.27 g/mol. Its IUPAC name is 1-benzyl-5-(2-bromophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-benzyl-5-(2-bromophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925780 |
| Molecular Formula | C19H17BrN4O3 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-benzyl-5-(2-bromophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | O=C1NC(c2ccccc2Br)C2C(=O)NC(=O)N(Cc3ccccc3)C2N1 |
| InChI | InChI=1S/C19H17BrN4O3/c20-13-9-5-4-8-12(13)15-14-16(22-18(26)21-15)24(19(27)23-17(14)25)10-11-6-2-1-3-7-11/h1-9,14-16H,10H2,(H2,21,22,26)(H,23,25,27) |
| InChIKey | SKSFTYDPLDMLGL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |