C19H16Cl2N4O3 — CID 74925790
1-benzyl-5-(3,4-dichlorophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925790) has the molecular formula C19H16Cl2N4O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is 1-benzyl-5-(3,4-dichlorophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-benzyl-5-(3,4-dichlorophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925790 |
| Molecular Formula | C19H16Cl2N4O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-benzyl-5-(3,4-dichlorophenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | O=C1NC(c2ccc(Cl)c(Cl)c2)C2C(=O)NC(=O)N(Cc3ccccc3)C2N1 |
| InChI | InChI=1S/C19H16Cl2N4O3/c20-12-7-6-11(8-13(12)21)15-14-16(23-18(27)22-15)25(19(28)24-17(14)26)9-10-4-2-1-3-5-10/h1-8,14-16H,9H2,(H2,22,23,27)(H,24,26,28) |
| InChIKey | RURXRIPJOSIBJA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |