C17H21N7S — CID 74926915
N-[[(2-aminophenyl)-pyridazin-3-ylmethylidene]amino]-4-methylpiperazine-1-carbothioamide (PubChem CID 74926915) has the molecular formula C17H21N7S and a molecular weight of 355.47 g/mol. Its IUPAC name is N-[[(2-aminophenyl)-pyridazin-3-ylmethylidene]amino]-4-methylpiperazine-1-carbothioamide.
| Compound Name | N-[[(2-aminophenyl)-pyridazin-3-ylmethylidene]amino]-4-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 74926915 |
| Molecular Formula | C17H21N7S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[[(2-aminophenyl)-pyridazin-3-ylmethylidene]amino]-4-methylpiperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)NN=C(c2cccnn2)c2ccccc2N)CC1 |
| InChI | InChI=1S/C17H21N7S/c1-23-9-11-24(12-10-23)17(25)22-21-16(15-7-4-8-19-20-15)13-5-2-3-6-14(13)18/h2-8H,9-12,18H2,1H3,(H,22,25) |
| InChIKey | OHKJJXIKFXUFME-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|