C25H37NO2Si2 — CID 74928404
3,5-bis[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 74928404) has the molecular formula C25H37NO2Si2 and a molecular weight of 439.75 g/mol. Its IUPAC name is 3,5-bis[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | 3,5-bis[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 74928404 |
| Molecular Formula | C25H37NO2Si2 |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3,5-bis[[dimethyl(phenyl)silyl]methyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | C[Si](C)(CC1CCC2C(O)C(O)C(C[Si](C)(C)c3ccccc3)N12)c1ccccc1 |
| InChI | InChI=1S/C25H37NO2Si2/c1-29(2,20-11-7-5-8-12-20)17-19-15-16-22-24(27)25(28)23(26(19)22)18-30(3,4)21-13-9-6-10-14-21/h5-14,19,22-25,27-28H,15-18H2,1-4H3 |
| InChIKey | OEFKGIWVRHZNFP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|