About pyridine-2,5-dicarboxylic acid
pyridine-2,5-dicarboxylic acid (PubChem CID 7493) has the molecular formula C7H5NO4
and a molecular weight of 167.12 g/mol. Its IUPAC name is pyridine-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | pyridine-2,5-dicarboxylic acid |
| PubChem CID | 7493 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | pyridine-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-2-5(7(11)12)8-3-4/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | LVPMIMZXDYBCDF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,5-dicarboxylic acid?
The IUPAC name of pyridine-2,5-dicarboxylic acid (CID 7493) is pyridine-2,5-dicarboxylic acid.
What is the SMILES notation for pyridine-2,5-dicarboxylic acid?
The canonical SMILES for pyridine-2,5-dicarboxylic acid is O=C(O)c1ccc(C(=O)O)nc1.
What is the InChIKey of pyridine-2,5-dicarboxylic acid?
The InChIKey is LVPMIMZXDYBCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4/c9-6(10)4-1-2-5(7(11)12)8-3-4/h1-3H,(H,9,10)(H,11,12).
What are the key properties of pyridine-2,5-dicarboxylic acid?
pyridine-2,5-dicarboxylic acid has a molecular weight of 167.12 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,5-dicarboxylic acid is sourced from PubChem (CID 7493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).