About N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide
N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 74931905) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide |
| PubChem CID | 74931905 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C=NOC(C)C)cc1C |
| InChI | InChI=1S/C16H25N3O/c1-7-19(6)11-17-16-9-13(4)15(8-14(16)5)10-18-20-12(2)3/h8-12H,7H2,1-6H3/b17-11+,18-10? |
| InChIKey | WQRPEGHDECMYRQ-OFAUYARESA-N |
| XLogP | 3.67 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide?
The IUPAC name of N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide (CID 74931905) is N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide.
What is the SMILES notation for N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide?
The canonical SMILES for N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide is CCN(C)/C=N/c1cc(C)c(C=NOC(C)C)cc1C.
What is the InChIKey of N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide?
The InChIKey is WQRPEGHDECMYRQ-OFAUYARESA-N. The full InChI is InChI=1S/C16H25N3O/c1-7-19(6)11-17-16-9-13(4)15(8-14(16)5)10-18-20-12(2)3/h8-12H,7H2,1-6H3/b17-11+,18-10?.
What are the key properties of N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide?
N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide has a molecular weight of 275.40 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2,5-dimethyl-4-(propan-2-yloxyiminomethyl)phenyl]-N-ethyl-N-methylmethanimidamide is sourced from PubChem (CID 74931905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).