C30H24Cl4N10S4Zn — CID 74934247
bis((3-methyl-1,3-thiazol-3-ium-2-yl)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)diazene);tetrachlorozinc(2-) (PubChem CID 74934247) has the molecular formula C30H24Cl4N10S4Zn and a molecular weight of 860.06 g/mol. Its IUPAC name is bis((3-methyl-1,3-thiazol-3-ium-2-yl)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)diazene);tetrachlorozinc(2-).
| Compound Name | bis((3-methyl-1,3-thiazol-3-ium-2-yl)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)diazene);tetrachlorozinc(2-) |
|---|---|
| PubChem CID | 74934247 |
| Molecular Formula | C30H24Cl4N10S4Zn |
| Molecular Weight | 860.06 g/mol |
| Exact Mass | 855.91 |
| IUPAC Name | bis((3-methyl-1,3-thiazol-3-ium-2-yl)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)diazene);tetrachlorozinc(2-) |
| SMILES | C[n+]1ccsc1N=Nc1c(-c2ccccc2)nc2sccn12.C[n+]1ccsc1N=Nc1c(-c2ccccc2)nc2sccn12.Cl[Zn-2](Cl)(Cl)Cl |
| InChI | InChI=1S/2C15H12N5S2.4ClH.Zn/c2*1-19-7-9-22-15(19)18-17-13-12(11-5-3-2-4-6-11)16-14-20(13)8-10-21-14;;;;;/h2*2-10H,1H3;4*1H;/q2*+1;;;;;+2/p-4 |
| InChIKey | XVZZOEFKKDVDNZ-UHFFFAOYSA-J |
| XLogP | 11.48 |
| TPSA | 91.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.06 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|