C18H21N3O5S — CID 7493456
2-[(2Z,5R)-2-[(E)-(5-ethoxy-5-oxopentan-2-ylidene)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 7493456) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(E)-(5-ethoxy-5-oxopentan-2-ylidene)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z,5R)-2-[(E)-(5-ethoxy-5-oxopentan-2-ylidene)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 7493456 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[(2Z,5R)-2-[(E)-(5-ethoxy-5-oxopentan-2-ylidene)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCOC(=O)CC/C(C)=N/N=C1\S[C@H](CC(=O)O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-3-26-16(24)10-9-12(2)19-20-18-21(13-7-5-4-6-8-13)17(25)14(27-18)11-15(22)23/h4-8,14H,3,9-11H2,1-2H3,(H,22,23)/b19-12+,20-18-/t14-/m1/s1 |
| InChIKey | GDMUZFFAUVTNPU-GILAVVNESA-N |
| XLogP | 2.68 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|