C18H29NO7 — CID 74934606
6-methylheptyl prop-2-enoate;2-(prop-2-enoylamino)butanedioic acid (PubChem CID 74934606) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-methylheptyl prop-2-enoate;2-(prop-2-enoylamino)butanedioic acid.
| Compound Name | 6-methylheptyl prop-2-enoate;2-(prop-2-enoylamino)butanedioic acid |
|---|---|
| PubChem CID | 74934606 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 6-methylheptyl prop-2-enoate;2-(prop-2-enoylamino)butanedioic acid |
| SMILES | C=CC(=O)NC(CC(=O)O)C(=O)O.C=CC(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C11H20O2.C7H9NO5/c1-4-11(12)13-9-7-5-6-8-10(2)3;1-2-5(9)8-4(7(12)13)3-6(10)11/h4,10H,1,5-9H2,2-3H3;2,4H,1,3H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | FLFVEPVKNNUMTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|