C15H19N3S2 — CID 7493843
(5S,6S,7R)-6,8-dimethyl-7-phenyl-1,3,8-triazaspiro[4.5]decane-2,4-dithione (PubChem CID 7493843) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (5S,6S,7R)-6,8-dimethyl-7-phenyl-1,3,8-triazaspiro[4.5]decane-2,4-dithione.
| Compound Name | (5S,6S,7R)-6,8-dimethyl-7-phenyl-1,3,8-triazaspiro[4.5]decane-2,4-dithione |
|---|---|
| PubChem CID | 7493843 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (5S,6S,7R)-6,8-dimethyl-7-phenyl-1,3,8-triazaspiro[4.5]decane-2,4-dithione |
| SMILES | C[C@H]1[C@H](c2ccccc2)N(C)CC[C@]12NC(=S)NC2=S |
| InChI | InChI=1S/C15H19N3S2/c1-10-12(11-6-4-3-5-7-11)18(2)9-8-15(10)13(19)16-14(20)17-15/h3-7,10,12H,8-9H2,1-2H3,(H2,16,17,19,20)/t10-,12+,15-/m0/s1 |
| InChIKey | QLIKARSSCIFZNJ-NVBFEUDRSA-N |
| XLogP | 2.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|