About N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide
N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide (PubChem CID 749387) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide |
| PubChem CID | 749387 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC2=CC(=O)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-11(19)17-12-4-6-13(7-5-12)18-14-8-15(20)10-16(2,3)9-14/h4-8,18H,9-10H2,1-3H3,(H,17,19) |
| InChIKey | HSFLSRSZBGYUGK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide?
The IUPAC name of N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide (CID 749387) is N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide?
The canonical SMILES for N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide is CC(=O)Nc1ccc(NC2=CC(=O)CC(C)(C)C2)cc1.
What is the InChIKey of N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide?
The InChIKey is HSFLSRSZBGYUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-11(19)17-12-4-6-13(7-5-12)18-14-8-15(20)10-16(2,3)9-14/h4-8,18H,9-10H2,1-3H3,(H,17,19).
What are the key properties of N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide?
N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide has a molecular weight of 272.35 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]phenyl]acetamide is sourced from PubChem (CID 749387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).