C24H19ClN2O3 — CID 7494074
(3S,3aS,6aR)-5-(3-chloro-2-methylphenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 7494074) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-(3-chloro-2-methylphenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aR)-5-(3-chloro-2-methylphenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 7494074 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (3S,3aS,6aR)-5-(3-chloro-2-methylphenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1c(Cl)cccc1N1C(=O)[C@H]2[C@@H](c3ccccc3)N(c3ccccc3)O[C@H]2C1=O |
| InChI | InChI=1S/C24H19ClN2O3/c1-15-18(25)13-8-14-19(15)26-23(28)20-21(16-9-4-2-5-10-16)27(30-22(20)24(26)29)17-11-6-3-7-12-17/h2-14,20-22H,1H3/t20-,21+,22+/m0/s1 |
| InChIKey | TXMYRMUHOJDGJQ-BHDDXSALSA-N |
| XLogP | 4.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|