About hept-6-en-2-yl acetate
hept-6-en-2-yl acetate (PubChem CID 74941339) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is hept-6-en-2-yl acetate.
Molecular Properties
| Compound Name | hept-6-en-2-yl acetate |
| PubChem CID | 74941339 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | hept-6-en-2-yl acetate |
| SMILES | C=CCCCC(C)OC(C)=O |
| InChI | InChI=1S/C9H16O2/c1-4-5-6-7-8(2)11-9(3)10/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | YSVUPNHQXJSBTC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-6-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-en-2-yl acetate?
The IUPAC name of hept-6-en-2-yl acetate (CID 74941339) is hept-6-en-2-yl acetate.
What is the SMILES notation for hept-6-en-2-yl acetate?
The canonical SMILES for hept-6-en-2-yl acetate is C=CCCCC(C)OC(C)=O.
What is the InChIKey of hept-6-en-2-yl acetate?
The InChIKey is YSVUPNHQXJSBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-5-6-7-8(2)11-9(3)10/h4,8H,1,5-7H2,2-3H3.
What are the key properties of hept-6-en-2-yl acetate?
hept-6-en-2-yl acetate has a molecular weight of 156.22 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-en-2-yl acetate is sourced from PubChem (CID 74941339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).