C18H17N3O5 — CID 7494298
2-(3-nitro-4-piperazin-4-ium-1-ylbenzoyl)benzoate (PubChem CID 7494298) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(3-nitro-4-piperazin-4-ium-1-ylbenzoyl)benzoate.
| Compound Name | 2-(3-nitro-4-piperazin-4-ium-1-ylbenzoyl)benzoate |
|---|---|
| PubChem CID | 7494298 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-(3-nitro-4-piperazin-4-ium-1-ylbenzoyl)benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)c1ccc(N2CC[NH2+]CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N3O5/c22-17(13-3-1-2-4-14(13)18(23)24)12-5-6-15(16(11-12)21(25)26)20-9-7-19-8-10-20/h1-6,11,19H,7-10H2,(H,23,24) |
| InChIKey | AACVSJWFFWHLJA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|