C23H22FN5O4 — CID 74943084
2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxyacetic acid (PubChem CID 74943084) has the molecular formula C23H22FN5O4 and a molecular weight of 451.46 g/mol. Its IUPAC name is 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 74943084 |
| Molecular Formula | C23H22FN5O4 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxyacetic acid |
| SMILES | COc1cccc(-c2cc(F)ccc2C2CC(=NOCC(=O)O)c3c(C)nc(N)nc3C2)n1 |
| InChI | InChI=1S/C23H22FN5O4/c1-12-22-18(28-23(25)26-12)8-13(9-19(22)29-33-11-21(30)31)15-7-6-14(24)10-16(15)17-4-3-5-20(27-17)32-2/h3-7,10,13H,8-9,11H2,1-2H3,(H,30,31)(H2,25,26,28) |
| InChIKey | NGNGBWVKMNXKCQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|