C37H45NO8S — CID 74944933
[4-[2-(7,11-dihydroxy-8,8,10,12-tetramethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl)prop-1-enyl]-1,3-thiazol-2-yl]methyl naphthalene-1-carboxylate (PubChem CID 74944933) has the molecular formula C37H45NO8S and a molecular weight of 663.83 g/mol. Its IUPAC name is [4-[2-(7,11-dihydroxy-8,8,10,12-tetramethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl)prop-1-enyl]-1,3-thiazol-2-yl]methyl naphthalene-1-carboxylate.
| Compound Name | [4-[2-(7,11-dihydroxy-8,8,10,12-tetramethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl)prop-1-enyl]-1,3-thiazol-2-yl]methyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 74944933 |
| Molecular Formula | C37H45NO8S |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | [4-[2-(7,11-dihydroxy-8,8,10,12-tetramethyl-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecan-3-yl)prop-1-enyl]-1,3-thiazol-2-yl]methyl naphthalene-1-carboxylate |
| SMILES | CC(=Cc1csc(COC(=O)c2cccc3ccccc23)n1)C1CC2OC2CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C37H45NO8S/c1-21-10-8-15-28-30(45-28)17-29(46-33(40)18-31(39)37(4,5)35(42)23(3)34(21)41)22(2)16-25-20-47-32(38-25)19-44-36(43)27-14-9-12-24-11-6-7-13-26(24)27/h6-7,9,11-14,16,20-21,23,28-31,34,39,41H,8,10,15,17-19H2,1-5H3 |
| InChIKey | KVXCDPNIOZXHSK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|