C29H28N3O3S+ — CID 74945007
9-[5-[[3-(3-hydroxyphenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]fluoren-9-ol (PubChem CID 74945007) has the molecular formula C29H28N3O3S+ and a molecular weight of 498.63 g/mol. Its IUPAC name is 9-[5-[[3-(3-hydroxyphenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]fluoren-9-ol.
| Compound Name | 9-[5-[[3-(3-hydroxyphenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]fluoren-9-ol |
|---|---|
| PubChem CID | 74945007 |
| Molecular Formula | C29H28N3O3S+ |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 9-[5-[[3-(3-hydroxyphenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]fluoren-9-ol |
| SMILES | Oc1cccc(SC2C[N+]3(Cc4nnc(C5(O)c6ccccc6-c6ccccc65)o4)CCC2CC3)c1 |
| InChI | InChI=1S/C29H27N3O3S/c33-20-6-5-7-21(16-20)36-26-17-32(14-12-19(26)13-15-32)18-27-30-31-28(35-27)29(34)24-10-3-1-8-22(24)23-9-2-4-11-25(23)29/h1-11,16,19,26,34H,12-15,17-18H2/p+1 |
| InChIKey | ZUGJQJJKYASTEI-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|