C12H17NO2 — CID 74945111
4-ethoxyimino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one (PubChem CID 74945111) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-ethoxyimino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-ethoxyimino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 74945111 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-ethoxyimino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one |
| SMILES | CCON=C1C=C(C(C)C)C(=O)C=C1C |
| InChI | InChI=1S/C12H17NO2/c1-5-15-13-11-7-10(8(2)3)12(14)6-9(11)4/h6-8H,5H2,1-4H3 |
| InChIKey | IAWIYAPCCZXIGI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|